C80H36F24O8 — CID 139125508
bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene-1,4-dicarboxylate (PubChem CID 139125508) has the molecular formula C80H36F24O8 and a molecular weight of 1581.11 g/mol. Its IUPAC name is bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene-1,4-dicarboxylate.
| Compound Name | bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139125508 |
| Molecular Formula | C80H36F24O8 |
| Molecular Weight | 1581.11 g/mol |
| Exact Mass | 1580.20 |
| IUPAC Name | bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene-1,4-dicarboxylate |
| SMILES | O=C(OCc1c(F)cc(F)cc1F)c1cc(C#Cc2ccc(C(F)(F)F)cc2)c(C(=O)OCc2c(F)cc(F)cc2F)cc1C#Cc1ccc(C(F)(F)F)cc1.O=C(OCc1c(F)cc(F)cc1F)c1cc(C#Cc2ccc(C(F)(F)F)cc2)c(C(=O)OCc2c(F)cc(F)cc2F)cc1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/2C40H18F12O4/c2*41-27-15-33(43)31(34(44)16-27)19-55-37(53)29-14-24(8-2-22-5-11-26(12-6-22)40(50,51)52)30(38(54)56-20-32-35(45)17-28(42)18-36(32)46)13-23(29)7-1-21-3-9-25(10-4-21)39(47,48)49/h2*3-6,9-18H,19-20H2 |
| InChIKey | VDTNTQUHTNJNJK-UHFFFAOYSA-N |
| XLogP | 20.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 112 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1581.11 |
| LogP ≤ 5 | 20.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|