C21H24CuF3N2O3S — CID 139128749
copper(1+);2,9-ditert-butyl-1,10-phenanthroline;trifluoromethanesulfonate (PubChem CID 139128749) has the molecular formula C21H24CuF3N2O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is copper(1+);2,9-ditert-butyl-1,10-phenanthroline;trifluoromethanesulfonate.
| Compound Name | copper(1+);2,9-ditert-butyl-1,10-phenanthroline;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139128749 |
| Molecular Formula | C21H24CuF3N2O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | copper(1+);2,9-ditert-butyl-1,10-phenanthroline;trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc2ccc3ccc(C(C)(C)C)nc3c2n1.O=S(=O)([O-])C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C20H24N2.CHF3O3S.Cu/c1-19(2,3)15-11-9-13-7-8-14-10-12-16(20(4,5)6)22-18(14)17(13)21-15;2-1(3,4)8(5,6)7;/h7-12H,1-6H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | VKZOFQRYOZQIJR-UHFFFAOYSA-M |
| XLogP | 5.43 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|