C25H16BNOS2 — CID 139129273
2,2-bis(1-benzothiophen-2-yl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 139129273) has the molecular formula C25H16BNOS2 and a molecular weight of 421.36 g/mol. Its IUPAC name is 2,2-bis(1-benzothiophen-2-yl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2,2-bis(1-benzothiophen-2-yl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 139129273 |
| Molecular Formula | C25H16BNOS2 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2,2-bis(1-benzothiophen-2-yl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | c1ccc2sc([B-]3(c4cc5ccccc5s4)Oc4cccc5ccc[n+]3c45)cc2c1 |
| InChI | InChI=1S/C25H16BNOS2/c1-3-12-21-18(7-1)15-23(29-21)26(24-16-19-8-2-4-13-22(19)30-24)27-14-6-10-17-9-5-11-20(28-26)25(17)27/h1-16H |
| InChIKey | SVKJQBTWLAELAG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|