C18H15AgBF12N5 — CID 139130953
silver;bis[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide;2,4,6-trimethylpyridine (PubChem CID 139130953) has the molecular formula C18H15AgBF12N5 and a molecular weight of 648.01 g/mol. Its IUPAC name is silver;bis[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide;2,4,6-trimethylpyridine.
| Compound Name | silver;bis[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide;2,4,6-trimethylpyridine |
|---|---|
| PubChem CID | 139130953 |
| Molecular Formula | C18H15AgBF12N5 |
| Molecular Weight | 648.01 g/mol |
| Exact Mass | 647.03 |
| IUPAC Name | silver;bis[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide;2,4,6-trimethylpyridine |
| SMILES | Cc1cc(C)nc(C)c1.FC(F)(F)c1cc(C(F)(F)F)n([BH2-]n2nc(C(F)(F)F)cc2C(F)(F)F)n1.[Ag+] |
| InChI | InChI=1S/C10H4BF12N4.C8H11N.Ag/c12-7(13,14)3-1-5(9(18,19)20)26(24-3)11-27-6(10(21,22)23)2-4(25-27)8(15,16)17;1-6-4-7(2)9-8(3)5-6;/h1-2H,11H2;4-5H,1-3H3;/q-1;;+1 |
| InChIKey | XAHGOVBBGMTOCS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.01 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|