C20H20F6N6-2 — CID 140780488
N,N-dimethyl-4-pentyl-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-3-amine (PubChem CID 140780488) has the molecular formula C20H20F6N6-2 and a molecular weight of 458.41 g/mol. Its IUPAC name is N,N-dimethyl-4-pentyl-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-3-amine.
| Compound Name | N,N-dimethyl-4-pentyl-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 140780488 |
| Molecular Formula | C20H20F6N6-2 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N,N-dimethyl-4-pentyl-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-3-amine |
| SMILES | CCCCCc1cc(-c2cc(C(F)(F)F)n[n-]2)nc(-c2cc(C(F)(F)F)n[n-]2)c1N(C)C |
| InChI | InChI=1S/C20H20F6N6/c1-4-5-6-7-11-8-12(13-9-15(30-28-13)19(21,22)23)27-17(18(11)32(2)3)14-10-16(31-29-14)20(24,25)26/h8-10H,4-7H2,1-3H3/q-2 |
| InChIKey | MOXDSJHUOLGAGL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|