C22H23F6N5-2 — CID 140780463
4-(3-ethylheptyl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 140780463) has the molecular formula C22H23F6N5-2 and a molecular weight of 471.45 g/mol. Its IUPAC name is 4-(3-ethylheptyl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 4-(3-ethylheptyl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 140780463 |
| Molecular Formula | C22H23F6N5-2 |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 4-(3-ethylheptyl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | CCCCC(CC)CCc1cc(-c2cc(C(F)(F)F)n[n-]2)nc(-c2cc(C(F)(F)F)n[n-]2)c1 |
| InChI | InChI=1S/C22H23F6N5/c1-3-5-6-13(4-2)7-8-14-9-15(17-11-19(32-30-17)21(23,24)25)29-16(10-14)18-12-20(33-31-18)22(26,27)28/h9-13H,3-8H2,1-2H3/q-2 |
| InChIKey | OTYXQSCUPQQRQY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |