C9H6F5NO — CID 139136787
(Z)-3,3,4,4,4-pentafluoro-1-pyridin-2-ylbut-1-en-2-ol (PubChem CID 139136787) has the molecular formula C9H6F5NO and a molecular weight of 239.14 g/mol. Its IUPAC name is (Z)-3,3,4,4,4-pentafluoro-1-pyridin-2-ylbut-1-en-2-ol.
| Compound Name | (Z)-3,3,4,4,4-pentafluoro-1-pyridin-2-ylbut-1-en-2-ol |
|---|---|
| PubChem CID | 139136787 |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (Z)-3,3,4,4,4-pentafluoro-1-pyridin-2-ylbut-1-en-2-ol |
| SMILES | O/C(=C\c1ccccn1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO/c10-8(11,9(12,13)14)7(16)5-6-3-1-2-4-15-6/h1-5,16H/b7-5- |
| InChIKey | FFXQPVLNQAHOPH-ALCCZGGFSA-N |
| XLogP | 3.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|