C12H11N2P — CID 174741500
1,2-dipyridin-2-ylethenylphosphane (PubChem CID 174741500) has the molecular formula C12H11N2P and a molecular weight of 214.21 g/mol. Its IUPAC name is 1,2-dipyridin-2-ylethenylphosphane.
| Compound Name | 1,2-dipyridin-2-ylethenylphosphane |
|---|---|
| PubChem CID | 174741500 |
| Molecular Formula | C12H11N2P |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1,2-dipyridin-2-ylethenylphosphane |
| SMILES | PC(=Cc1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C12H11N2P/c15-12(11-6-2-4-8-14-11)9-10-5-1-3-7-13-10/h1-9H,15H2 |
| InChIKey | RIHWZUYJBZSBDH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|