C20H10F14N2O2Pd — CID 139136790
bis((Z)-3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpent-1-en-2-olate);palladium(2+) (PubChem CID 139136790) has the molecular formula C20H10F14N2O2Pd and a molecular weight of 682.70 g/mol. Its IUPAC name is bis((Z)-3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpent-1-en-2-olate);palladium(2+).
| Compound Name | bis((Z)-3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpent-1-en-2-olate);palladium(2+) |
|---|---|
| PubChem CID | 139136790 |
| Molecular Formula | C20H10F14N2O2Pd |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 681.96 |
| IUPAC Name | bis((Z)-3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpent-1-en-2-olate);palladium(2+) |
| SMILES | [O-]/C(=C\c1ccccn1)C(F)(F)C(F)(F)C(F)(F)F.[O-]/C(=C\c1ccccn1)C(F)(F)C(F)(F)C(F)(F)F.[Pd+2] |
| InChI | InChI=1S/2C10H6F7NO.Pd/c2*11-8(12,9(13,14)10(15,16)17)7(19)5-6-3-1-2-4-18-6;/h2*1-5,19H;/q;;+2/p-2/b2*7-5-; |
| InChIKey | OZSHXJPYTXJGMT-AGRVASMDSA-L |
| XLogP | 5.23 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|