C22H25NSi — CID 139140231
1,1,1-triphenyl-N-trimethylsilylmethanamine (PubChem CID 139140231) has the molecular formula C22H25NSi and a molecular weight of 331.54 g/mol. Its IUPAC name is 1,1,1-triphenyl-N-trimethylsilylmethanamine.
| Compound Name | 1,1,1-triphenyl-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 139140231 |
| Molecular Formula | C22H25NSi |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1,1,1-triphenyl-N-trimethylsilylmethanamine |
| SMILES | C[Si](C)(C)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NSi/c1-24(2,3)23-22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18,23H,1-3H3 |
| InChIKey | FUDBRZJYEXRKCD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|