C39H39N5O2Zn — CID 139141350
zinc;2,4-ditert-butyl-6-[[2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]phenyl]iminomethyl]phenolate;pyridine (PubChem CID 139141350) has the molecular formula C39H39N5O2Zn and a molecular weight of 675.16 g/mol. Its IUPAC name is zinc;2,4-ditert-butyl-6-[[2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]phenyl]iminomethyl]phenolate;pyridine.
| Compound Name | zinc;2,4-ditert-butyl-6-[[2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]phenyl]iminomethyl]phenolate;pyridine |
|---|---|
| PubChem CID | 139141350 |
| Molecular Formula | C39H39N5O2Zn |
| Molecular Weight | 675.16 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | zinc;2,4-ditert-butyl-6-[[2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]phenyl]iminomethyl]phenolate;pyridine |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2/N=C/c2cc(/N=N/c3ccccc3)ccc2[O-])c([O-])c(C(C)(C)C)c1.[Zn+2].c1ccncc1 |
| InChI | InChI=1S/C34H36N4O2.C5H5N.Zn/c1-33(2,3)25-18-24(32(40)28(20-25)34(4,5)6)22-36-30-15-11-10-14-29(30)35-21-23-19-27(16-17-31(23)39)38-37-26-12-8-7-9-13-26;1-2-4-6-5-3-1;/h7-22,39-40H,1-6H3;1-5H;/q;;+2/p-2/b35-21+,36-22+,38-37+;; |
| InChIKey | TXKSKIVNZOAXJR-TZZJUJSSSA-L |
| XLogP | 9.42 |
| TPSA | 108.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.16 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|