C50H31N3OPd — CID 139143451
(5,10,15,20-tetraphenyl-21-oxyazuliporphyrinato)-palladium(ii) (PubChem CID 139143451) has the molecular formula C50H31N3OPd and a molecular weight of 796.24 g/mol.
| Compound Name | (5,10,15,20-tetraphenyl-21-oxyazuliporphyrinato)-palladium(ii) |
|---|---|
| PubChem CID | 139143451 |
| Molecular Formula | C50H31N3OPd |
| Molecular Weight | 796.24 g/mol |
| Exact Mass | 795.15 |
| IUPAC Name | — |
| SMILES | [O-]C1=C2c3cccc[cH+]c3/C1=C(\c1ccccc1)c1ccc([n-]1)[C+](c1ccccc1)c1ccc([n-]1)[C+](c1ccccc1)c1ccc([n-]1)[C+]2c1ccccc1.[Pd] |
| InChI | InChI=1S/C50H31N3O.Pd/c54-50-48-36-24-14-5-15-25-37(36)49(50)47(35-22-12-4-13-23-35)43-31-29-41(53-43)45(33-18-8-2-9-19-33)39-27-26-38(51-39)44(32-16-6-1-7-17-32)40-28-30-42(52-40)46(48)34-20-10-3-11-21-34;/h1-31H;/b48-46-; |
| InChIKey | QPBWXYCQPWKCRO-MCFDIJQSSA-N |
| XLogP | 8.90 |
| TPSA | 65.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.24 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|