C38H24N4NiO — CID 139179806
nickel(2+);10,15,20-triphenylporphyrin-15,20-diylium-21,22,23,24-tetraid-5-ol (PubChem CID 139179806) has the molecular formula C38H24N4NiO and a molecular weight of 611.33 g/mol. Its IUPAC name is nickel(2+);10,15,20-triphenylporphyrin-15,20-diylium-21,22,23,24-tetraid-5-ol.
| Compound Name | nickel(2+);10,15,20-triphenylporphyrin-15,20-diylium-21,22,23,24-tetraid-5-ol |
|---|---|
| PubChem CID | 139179806 |
| Molecular Formula | C38H24N4NiO |
| Molecular Weight | 611.33 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | nickel(2+);10,15,20-triphenylporphyrin-15,20-diylium-21,22,23,24-tetraid-5-ol |
| SMILES | Oc1c2ccc([n-]2)c(-c2ccccc2)c2ccc([n-]2)[c+](-c2ccccc2)c2ccc([n-]2)[c+](-c2ccccc2)c2ccc1[n-]2.[Ni+2] |
| InChI | InChI=1S/C38H24N4O.Ni/c43-38-33-22-20-31(41-33)36(25-12-6-2-7-13-25)29-18-16-27(39-29)35(24-10-4-1-5-11-24)28-17-19-30(40-28)37(26-14-8-3-9-15-26)32-21-23-34(38)42-32;/h1-23,43H;/q-2;+2/b36-31-,38-33+; |
| InChIKey | RFBVDTYOODLEEI-DGWURSMKSA-N |
| XLogP | 8.52 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.33 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|