C34H24F2N3OPt- — CID 59399223
(Z)-2-anthracen-9-yl-1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]ethenol;platinum (PubChem CID 59399223) has the molecular formula C34H24F2N3OPt- and a molecular weight of 723.66 g/mol. Its IUPAC name is (Z)-2-anthracen-9-yl-1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]ethenol;platinum.
| Compound Name | (Z)-2-anthracen-9-yl-1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]ethenol;platinum |
|---|---|
| PubChem CID | 59399223 |
| Molecular Formula | C34H24F2N3OPt- |
| Molecular Weight | 723.66 g/mol |
| Exact Mass | 723.15 |
| IUPAC Name | (Z)-2-anthracen-9-yl-1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]ethenol;platinum |
| SMILES | CC(C)(c1cccc(/C(O)=C/c2c3ccccc3cc3ccccc23)n1)c1cccc(-c2[c-]cc(F)nc2F)n1.[Pt] |
| InChI | InChI=1S/C34H24F2N3O.Pt/c1-34(2,30-15-7-13-27(37-30)25-17-18-32(35)39-33(25)36)31-16-8-14-28(38-31)29(40)20-26-23-11-5-3-9-21(23)19-22-10-4-6-12-24(22)26;/h3-16,18-20,40H,1-2H3;/q-1;/b29-20-; |
| InChIKey | VYJSHUYQAICFPU-XVSWSKOJSA-N |
| XLogP | 8.30 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|