C24H24F2N3OPt- — CID 59399080
1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol;platinum (PubChem CID 59399080) has the molecular formula C24H24F2N3OPt- and a molecular weight of 603.55 g/mol. Its IUPAC name is 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol;platinum.
| Compound Name | 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol;platinum |
|---|---|
| PubChem CID | 59399080 |
| Molecular Formula | C24H24F2N3OPt- |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]cyclohexan-1-ol;platinum |
| SMILES | CC(C)(c1cccc(-c2[c-]cc(F)nc2F)n1)c1cccc(C2(O)CCCCC2)n1.[Pt] |
| InChI | InChI=1S/C24H24F2N3O.Pt/c1-23(2,19-10-7-11-20(28-19)24(30)14-4-3-5-15-24)18-9-6-8-17(27-18)16-12-13-21(25)29-22(16)26;/h6-11,13,30H,3-5,14-15H2,1-2H3;/q-1; |
| InChIKey | QRTYLIPEYOCRSJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|