C21H20F2N3OPt- — CID 59399183
2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol;platinum (PubChem CID 59399183) has the molecular formula C21H20F2N3OPt- and a molecular weight of 563.49 g/mol. Its IUPAC name is 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol;platinum.
| Compound Name | 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol;platinum |
|---|---|
| PubChem CID | 59399183 |
| Molecular Formula | C21H20F2N3OPt- |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol;platinum |
| SMILES | CC(C)(O)c1cccc(C(C)(C)c2cccc(-c3[c-]cc(F)nc3F)n2)n1.[Pt] |
| InChI | InChI=1S/C21H20F2N3O.Pt/c1-20(2,16-9-6-10-17(25-16)21(3,4)27)15-8-5-7-14(24-15)13-11-12-18(22)26-19(13)23;/h5-10,12,27H,1-4H3;/q-1; |
| InChIKey | JOCWCGSENJSMJM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|