C19H16F2N3OPt- — CID 59399259
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol;platinum (PubChem CID 59399259) has the molecular formula C19H16F2N3OPt- and a molecular weight of 535.43 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol;platinum.
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol;platinum |
|---|---|
| PubChem CID | 59399259 |
| Molecular Formula | C19H16F2N3OPt- |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol;platinum |
| SMILES | CC(C)(c1cccc(CO)n1)c1cccc(-c2[c-]cc(F)nc2F)n1.[Pt] |
| InChI | InChI=1S/C19H16F2N3O.Pt/c1-19(2,15-7-3-5-12(11-25)22-15)16-8-4-6-14(23-16)13-9-10-17(20)24-18(13)21;/h3-8,10,25H,11H2,1-2H3;/q-1; |
| InChIKey | DEWOXGCGBIMLFF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|