C26H22F2N3OPt- — CID 59399109
1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1-phenylethanol;platinum (PubChem CID 59399109) has the molecular formula C26H22F2N3OPt- and a molecular weight of 625.56 g/mol. Its IUPAC name is 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1-phenylethanol;platinum.
| Compound Name | 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1-phenylethanol;platinum |
|---|---|
| PubChem CID | 59399109 |
| Molecular Formula | C26H22F2N3OPt- |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | 1-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1-phenylethanol;platinum |
| SMILES | CC(C)(c1cccc(-c2[c-]cc(F)nc2F)n1)c1cccc(C(C)(O)c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C26H22F2N3O.Pt/c1-25(2,20-12-7-11-19(29-20)18-15-16-23(27)31-24(18)28)21-13-8-14-22(30-21)26(3,32)17-9-5-4-6-10-17;/h4-14,16,32H,1-3H3;/q-1; |
| InChIKey | IHOOURQLGHDWRZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|