C44H29AuN4O — CID 15977414
gold(3+);(1Z,10Z,14Z)-5,10,15,20-tetraphenylporphyrin-22,23,24-triid-5-ol (PubChem CID 15977414) has the molecular formula C44H29AuN4O and a molecular weight of 826.71 g/mol. Its IUPAC name is gold(3+);(1Z,10Z,14Z)-5,10,15,20-tetraphenylporphyrin-22,23,24-triid-5-ol.
| Compound Name | gold(3+);(1Z,10Z,14Z)-5,10,15,20-tetraphenylporphyrin-22,23,24-triid-5-ol |
|---|---|
| PubChem CID | 15977414 |
| Molecular Formula | C44H29AuN4O |
| Molecular Weight | 826.71 g/mol |
| Exact Mass | 826.20 |
| IUPAC Name | gold(3+);(1Z,10Z,14Z)-5,10,15,20-tetraphenylporphyrin-22,23,24-triid-5-ol |
| SMILES | OC1(c2ccccc2)C2=N/C(=C(/c3ccccc3)c3ccc([n-]3)/C(c3ccccc3)=c3/cc/c([n-]3)=C(\c3ccccc3)c3ccc1[n-]3)C=C2.[Au+3] |
| InChI | InChI=1S/C44H29N4O.Au/c49-44(32-19-11-4-12-20-32)39-27-25-37(47-39)42(30-15-7-2-8-16-30)35-23-21-33(45-35)41(29-13-5-1-6-14-29)34-22-24-36(46-34)43(31-17-9-3-10-18-31)38-26-28-40(44)48-38;/h1-28,49H;/q-3;+3/b41-33-,42-35-,43-38-; |
| InChIKey | NEEURWSYRUTKQZ-MXTXBXEBSA-N |
| XLogP | 6.07 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |