C48H40N4O — CID 91558271
[4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]methanol (PubChem CID 91558271) has the molecular formula C48H40N4O and a molecular weight of 688.88 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]methanol.
| Compound Name | [4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 91558271 |
| Molecular Formula | C48H40N4O |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | [4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]methanol |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc([nH]3)C(c3ccc(CO)cc3)=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C48H40N4O/c1-29-4-12-33(13-5-29)45-37-20-22-39(49-37)46(34-14-6-30(2)7-15-34)41-24-26-43(51-41)48(36-18-10-32(28-53)11-19-36)44-27-25-42(52-44)47(40-23-21-38(45)50-40)35-16-8-31(3)9-17-35/h4-27,49-53H,28H2,1-3H3 |
| InChIKey | FQBXGMWVDBUSCC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |