C41H34N4 — CID 54563793
5,10,15-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 54563793) has the molecular formula C41H34N4 and a molecular weight of 582.75 g/mol. Its IUPAC name is 5,10,15-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54563793 |
| Molecular Formula | C41H34N4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 5,10,15-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3ccc(C)cc3)=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C41H34N4/c1-25-4-10-28(11-5-25)39-33-18-16-31(42-33)24-32-17-19-34(43-32)40(29-12-6-26(2)7-13-29)36-21-23-38(45-36)41(37-22-20-35(39)44-37)30-14-8-27(3)9-15-30/h4-24,42-45H,1-3H3 |
| InChIKey | LFUHAFCUQQTIOM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |