C17H20N12O — CID 139144273
methanol;bis(6-pyridin-4-yl-1,3,5-triazine-2,4-diamine) (PubChem CID 139144273) has the molecular formula C17H20N12O and a molecular weight of 408.43 g/mol. Its IUPAC name is methanol;bis(6-pyridin-4-yl-1,3,5-triazine-2,4-diamine).
| Compound Name | methanol;bis(6-pyridin-4-yl-1,3,5-triazine-2,4-diamine) |
|---|---|
| PubChem CID | 139144273 |
| Molecular Formula | C17H20N12O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | methanol;bis(6-pyridin-4-yl-1,3,5-triazine-2,4-diamine) |
| SMILES | CO.Nc1nc(N)nc(-c2ccncc2)n1.Nc1nc(N)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/2C8H8N6.CH4O/c2*9-7-12-6(13-8(10)14-7)5-1-3-11-4-2-5;1-2/h2*1-4H,(H4,9,10,12,13,14);2H,1H3 |
| InChIKey | PONUDCNOADZZCX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 227.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |