C29H24N2O3 — CID 139144824
3-hydroxybenzoic acid;bis(4-phenylpyridine) (PubChem CID 139144824) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-hydroxybenzoic acid;bis(4-phenylpyridine).
| Compound Name | 3-hydroxybenzoic acid;bis(4-phenylpyridine) |
|---|---|
| PubChem CID | 139144824 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-hydroxybenzoic acid;bis(4-phenylpyridine) |
| SMILES | O=C(O)c1cccc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/2C11H9N.C7H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;8-6-3-1-2-5(4-6)7(9)10/h2*1-9H;1-4,8H,(H,9,10) |
| InChIKey | KYRKCNKVDMNZQA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |