3-hydroxybenzoic acid;bis(4-phenylpyridine)

C29H24N2O3 — CID 139144824

IUPAC3-hydroxybenzoic acid;bis(4-phenylpyridine)
SMILESO=C(O)c1cccc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1
InChIInChI=1S/2C11H9N.C7H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;8-6-3-1-2-5(4-6)7(9)10/h2*1-9H;1-4,8H,(H,9,10)
InChIKeyKYRKCNKVDMNZQA-UHFFFAOYSA-N
MW448.52 g/mol
LogP6.59
Rot. Bonds3

About 3-hydroxybenzoic acid;bis(4-phenylpyridine)

3-hydroxybenzoic acid;bis(4-phenylpyridine) (PubChem CID 139144824) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-hydroxybenzoic acid;bis(4-phenylpyridine).

Molecular Properties

Compound Name3-hydroxybenzoic acid;bis(4-phenylpyridine)
PubChem CID139144824
Molecular FormulaC29H24N2O3
Molecular Weight448.52 g/mol
Exact Mass448.18
IUPAC Name3-hydroxybenzoic acid;bis(4-phenylpyridine)
SMILESO=C(O)c1cccc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1
InChIInChI=1S/2C11H9N.C7H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;8-6-3-1-2-5(4-6)7(9)10/h2*1-9H;1-4,8H,(H,9,10)
InChIKeyKYRKCNKVDMNZQA-UHFFFAOYSA-N
XLogP6.59
TPSA83.31 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500448.52
LogP ≤ 56.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-hydroxybenzoic acid;bis(4-phenylpyridine) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxybenzoic acid;bis(4-phenylpyridine)?
The IUPAC name of 3-hydroxybenzoic acid;bis(4-phenylpyridine) (CID 139144824) is 3-hydroxybenzoic acid;bis(4-phenylpyridine).
What is the SMILES notation for 3-hydroxybenzoic acid;bis(4-phenylpyridine)?
The canonical SMILES for 3-hydroxybenzoic acid;bis(4-phenylpyridine) is O=C(O)c1cccc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1.
What is the InChIKey of 3-hydroxybenzoic acid;bis(4-phenylpyridine)?
The InChIKey is KYRKCNKVDMNZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H9N.C7H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;8-6-3-1-2-5(4-6)7(9)10/h2*1-9H;1-4,8H,(H,9,10).
What are the key properties of 3-hydroxybenzoic acid;bis(4-phenylpyridine)?
3-hydroxybenzoic acid;bis(4-phenylpyridine) has a molecular weight of 448.52 g/mol, XLogP of 6.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybenzoic acid;bis(4-phenylpyridine) is sourced from PubChem (CID 139144824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).