C41H43I3O3 — CID 139145034
1,3,5-triethyl-2,4,6-tris[(4-iodophenoxy)methyl]benzene;1,3-xylene (PubChem CID 139145034) has the molecular formula C41H43I3O3 and a molecular weight of 964.50 g/mol. Its IUPAC name is 1,3,5-triethyl-2,4,6-tris[(4-iodophenoxy)methyl]benzene;1,3-xylene.
| Compound Name | 1,3,5-triethyl-2,4,6-tris[(4-iodophenoxy)methyl]benzene;1,3-xylene |
|---|---|
| PubChem CID | 139145034 |
| Molecular Formula | C41H43I3O3 |
| Molecular Weight | 964.50 g/mol |
| Exact Mass | 964.03 |
| IUPAC Name | 1,3,5-triethyl-2,4,6-tris[(4-iodophenoxy)methyl]benzene;1,3-xylene |
| SMILES | CCc1c(COc2ccc(I)cc2)c(CC)c(COc2ccc(I)cc2)c(CC)c1COc1ccc(I)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C33H33I3O3.C8H10/c1-4-28-31(19-37-25-13-7-22(34)8-14-25)29(5-2)33(21-39-27-17-11-24(36)12-18-27)30(6-3)32(28)20-38-26-15-9-23(35)10-16-26;1-7-4-3-5-8(2)6-7/h7-18H,4-6,19-21H2,1-3H3;3-6H,1-2H3 |
| InChIKey | IEIFCQXSHVGEAN-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.50 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|