C22H38N6O7 — CID 139146503
bis(1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium);phthalate;trihydrate (PubChem CID 139146503) has the molecular formula C22H38N6O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is bis(1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium);phthalate;trihydrate.
| Compound Name | bis(1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium);phthalate;trihydrate |
|---|---|
| PubChem CID | 139146503 |
| Molecular Formula | C22H38N6O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | bis(1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium);phthalate;trihydrate |
| SMILES | C1CNC2=[N+](C1)CCCN2.C1CNC2=[N+](C1)CCCN2.O.O.O.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C7H13N3.3H2O/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-3-8-7-9-4-2-6-10(7)5-1;;;/h1-4H,(H,9,10)(H,11,12);2*1-6H2,(H,8,9);3*1H2 |
| InChIKey | FYHQCNJSSHIRHA-UHFFFAOYSA-N |
| XLogP | -5.38 |
| TPSA | 228.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|