C26H38N4O4 — CID 153324496
bis(3,4,5,6,7,8,9,10-octahydro-2H-pyrimido[1,2-a]azepin-5-ium);phthalate (PubChem CID 153324496) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is bis(3,4,5,6,7,8,9,10-octahydro-2H-pyrimido[1,2-a]azepin-5-ium);phthalate.
| Compound Name | bis(3,4,5,6,7,8,9,10-octahydro-2H-pyrimido[1,2-a]azepin-5-ium);phthalate |
|---|---|
| PubChem CID | 153324496 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | bis(3,4,5,6,7,8,9,10-octahydro-2H-pyrimido[1,2-a]azepin-5-ium);phthalate |
| SMILES | C1CCC2=NCCC[NH+]2CC1.C1CCC2=NCCC[NH+]2CC1.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/2C9H16N2.C8H6O4/c2*1-2-5-9-10-6-4-8-11(9)7-3-1;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*1-8H2;1-4H,(H,9,10)(H,11,12) |
| InChIKey | KPVDPRXXPCZGQG-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |