C21H30N2O3 — CID 160822642
2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium;2-pentanoylbenzoate (PubChem CID 160822642) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium;2-pentanoylbenzoate.
| Compound Name | 2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium;2-pentanoylbenzoate |
|---|---|
| PubChem CID | 160822642 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium;2-pentanoylbenzoate |
| SMILES | C1CCC2=[N+](CC1)CCCN2.CCCCC(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C12H14O3.C9H16N2/c1-2-3-8-11(13)9-6-4-5-7-10(9)12(14)15;1-2-5-9-10-6-4-8-11(9)7-3-1/h4-7H,2-3,8H2,1H3,(H,14,15);1-8H2 |
| InChIKey | SFTBLOXUFYPEKA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|