C20H28N2O4 — CID 159747442
2-(4-hydroxybutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium (PubChem CID 159747442) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-(4-hydroxybutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium.
| Compound Name | 2-(4-hydroxybutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 159747442 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(4-hydroxybutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
| SMILES | C1CCC2=[N+](CC1)CCCN2.O=C([O-])c1ccccc1C(=O)CCCO |
| InChI | InChI=1S/C11H12O4.C9H16N2/c12-7-3-6-10(13)8-4-1-2-5-9(8)11(14)15;1-2-5-9-10-6-4-8-11(9)7-3-1/h1-2,4-5,12H,3,6-7H2,(H,14,15);1-8H2 |
| InChIKey | NDFHSLVUOSUKFF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|