C22H32N2O3 — CID 157308716
2-(3,3-dimethylbutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium (PubChem CID 157308716) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(3,3-dimethylbutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium.
| Compound Name | 2-(3,3-dimethylbutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 157308716 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-(3,3-dimethylbutanoyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
| SMILES | C1CCC2=[N+](CC1)CCCN2.CC(C)(C)CC(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C13H16O3.C9H16N2/c1-13(2,3)8-11(14)9-6-4-5-7-10(9)12(15)16;1-2-5-9-10-6-4-8-11(9)7-3-1/h4-7H,8H2,1-3H3,(H,15,16);1-8H2 |
| InChIKey | BCUDEPJRLCYBSE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|