C18H26N4O4 — CID 160913395
bis(1-ethyl-4,5-dihydro-1H-imidazol-1-ium);phthalate (PubChem CID 160913395) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is bis(1-ethyl-4,5-dihydro-1H-imidazol-1-ium);phthalate.
| Compound Name | bis(1-ethyl-4,5-dihydro-1H-imidazol-1-ium);phthalate |
|---|---|
| PubChem CID | 160913395 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | bis(1-ethyl-4,5-dihydro-1H-imidazol-1-ium);phthalate |
| SMILES | CC[NH+]1C=NCC1.CC[NH+]1C=NCC1.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C5H10N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2-7-4-3-6-5-7/h1-4H,(H,9,10)(H,11,12);2*5H,2-4H2,1H3 |
| InChIKey | SRBYRDFCXMFRHK-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |