C96H72N4O16 — CID 139147934
dibenzyl 4-[4-[2,6-bis(phenylmethoxycarbonyl)-4-pyridinyl]phenyl]pyridine-2,6-dicarboxylate (PubChem CID 139147934) has the molecular formula C96H72N4O16 and a molecular weight of 1537.64 g/mol. Its IUPAC name is dibenzyl 4-[4-[2,6-bis(phenylmethoxycarbonyl)-4-pyridinyl]phenyl]pyridine-2,6-dicarboxylate.
| Compound Name | dibenzyl 4-[4-[2,6-bis(phenylmethoxycarbonyl)-4-pyridinyl]phenyl]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 139147934 |
| Molecular Formula | C96H72N4O16 |
| Molecular Weight | 1537.64 g/mol |
| Exact Mass | 1536.49 |
| IUPAC Name | dibenzyl 4-[4-[2,6-bis(phenylmethoxycarbonyl)-4-pyridinyl]phenyl]pyridine-2,6-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc(-c2ccc(-c3cc(C(=O)OCc4ccccc4)nc(C(=O)OCc4ccccc4)c3)cc2)cc(C(=O)OCc2ccccc2)n1.O=C(OCc1ccccc1)c1cc(-c2ccc(-c3cc(C(=O)OCc4ccccc4)nc(C(=O)OCc4ccccc4)c3)cc2)cc(C(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/2C48H36N2O8/c2*51-45(55-29-33-13-5-1-6-14-33)41-25-39(26-42(49-41)46(52)56-30-34-15-7-2-8-16-34)37-21-23-38(24-22-37)40-27-43(47(53)57-31-35-17-9-3-10-18-35)50-44(28-40)48(54)58-32-36-19-11-4-12-20-36/h2*1-28H,29-32H2 |
| InChIKey | QMDAUTNWGFGGRT-UHFFFAOYSA-N |
| XLogP | 18.48 |
| TPSA | 261.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1537.64 |
| LogP ≤ 5 | 18.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|