C23H21NO4 — CID 7473113
bis[(4-methylphenyl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 7473113) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is bis[(4-methylphenyl)methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(4-methylphenyl)methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 7473113 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | bis[(4-methylphenyl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | Cc1ccc(COC(=O)c2cccc(C(=O)OCc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H21NO4/c1-16-6-10-18(11-7-16)14-27-22(25)20-4-3-5-21(24-20)23(26)28-15-19-12-8-17(2)9-13-19/h3-13H,14-15H2,1-2H3 |
| InChIKey | JIGXWSCEVCLPIQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |