C52H44P4S2 — CID 139155278
[(1R,2R,3R,4R)-2,3-bis(diphenylphosphanyl)-4-diphenylphosphinothioylcyclobutyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 139155278) has the molecular formula C52H44P4S2 and a molecular weight of 856.95 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-2,3-bis(diphenylphosphanyl)-4-diphenylphosphinothioylcyclobutyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [(1R,2R,3R,4R)-2,3-bis(diphenylphosphanyl)-4-diphenylphosphinothioylcyclobutyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 139155278 |
| Molecular Formula | C52H44P4S2 |
| Molecular Weight | 856.95 g/mol |
| Exact Mass | 856.18 |
| IUPAC Name | [(1R,2R,3R,4R)-2,3-bis(diphenylphosphanyl)-4-diphenylphosphinothioylcyclobutyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)[C@@H]1[C@H](P(c2ccccc2)c2ccccc2)[C@@H](P(c2ccccc2)c2ccccc2)[C@H]1P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H44P4S2/c57-55(45-33-17-5-18-34-45,46-35-19-6-20-36-46)51-49(53(41-25-9-1-10-26-41)42-27-11-2-12-28-42)50(54(43-29-13-3-14-30-43)44-31-15-4-16-32-44)52(51)56(58,47-37-21-7-22-38-47)48-39-23-8-24-40-48/h1-40,49-52H/t49-,50-,51-,52-/m1/s1 |
| InChIKey | YXEZCHYNNFETQS-MELFUQDXSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.95 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|