C31H28P2 — CID 121418974
[(2R,3R)-3-diphenylphosphanyl-2-bicyclo[2.2.1]hept-1(6)-enyl]-diphenylphosphane (PubChem CID 121418974) has the molecular formula C31H28P2 and a molecular weight of 462.51 g/mol. Its IUPAC name is [(2R,3R)-3-diphenylphosphanyl-2-bicyclo[2.2.1]hept-1(6)-enyl]-diphenylphosphane.
| Compound Name | [(2R,3R)-3-diphenylphosphanyl-2-bicyclo[2.2.1]hept-1(6)-enyl]-diphenylphosphane |
|---|---|
| PubChem CID | 121418974 |
| Molecular Formula | C31H28P2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(2R,3R)-3-diphenylphosphanyl-2-bicyclo[2.2.1]hept-1(6)-enyl]-diphenylphosphane |
| SMILES | C1=C2CC(C1)[C@@H](P(c1ccccc1)c1ccccc1)[C@@H]2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28P2/c1-5-13-26(14-6-1)32(27-15-7-2-8-16-27)30-24-21-22-25(23-24)31(30)33(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-21,25,30-31H,22-23H2/t25?,30-,31-/m1/s1 |
| InChIKey | ZIAOVIMJQSVLRJ-WDDQFJLLSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|