C29H46N2Si2 — CID 139155584
(Z,3Z)-1,3-bis(4-tert-butylphenyl)-N-trimethylsilyl-3-trimethylsilyliminoprop-1-en-1-amine (PubChem CID 139155584) has the molecular formula C29H46N2Si2 and a molecular weight of 478.87 g/mol. Its IUPAC name is (Z,3Z)-1,3-bis(4-tert-butylphenyl)-N-trimethylsilyl-3-trimethylsilyliminoprop-1-en-1-amine.
| Compound Name | (Z,3Z)-1,3-bis(4-tert-butylphenyl)-N-trimethylsilyl-3-trimethylsilyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 139155584 |
| Molecular Formula | C29H46N2Si2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | (Z,3Z)-1,3-bis(4-tert-butylphenyl)-N-trimethylsilyl-3-trimethylsilyliminoprop-1-en-1-amine |
| SMILES | CC(C)(C)c1ccc(/C(=C/C(=N/[Si](C)(C)C)c2ccc(C(C)(C)C)cc2)N[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C29H46N2Si2/c1-28(2,3)24-17-13-22(14-18-24)26(30-32(7,8)9)21-27(31-33(10,11)12)23-15-19-25(20-16-23)29(4,5)6/h13-21,30H,1-12H3/b26-21-,31-27- |
| InChIKey | RZEDKAGYPRXGEY-JJMXMMSTSA-N |
| XLogP | 8.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|