C24H30 — CID 102332015
1-tert-butyl-4-[3-(4-tert-butylphenyl)buta-1,3-dien-2-yl]benzene (PubChem CID 102332015) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-tert-butyl-4-[3-(4-tert-butylphenyl)buta-1,3-dien-2-yl]benzene.
| Compound Name | 1-tert-butyl-4-[3-(4-tert-butylphenyl)buta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 102332015 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-tert-butyl-4-[3-(4-tert-butylphenyl)buta-1,3-dien-2-yl]benzene |
| SMILES | C=C(C(=C)c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H30/c1-17(19-9-13-21(14-10-19)23(3,4)5)18(2)20-11-15-22(16-12-20)24(6,7)8/h9-16H,1-2H2,3-8H3 |
| InChIKey | LHSJNCFOICZGJF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|