C15H18F2 — CID 142957884
1-(1,1-difluoroethyl)-4-[(3Z)-3-ethylpenta-1,3-dien-2-yl]benzene (PubChem CID 142957884) has the molecular formula C15H18F2 and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-4-[(3Z)-3-ethylpenta-1,3-dien-2-yl]benzene.
| Compound Name | 1-(1,1-difluoroethyl)-4-[(3Z)-3-ethylpenta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142957884 |
| Molecular Formula | C15H18F2 |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(1,1-difluoroethyl)-4-[(3Z)-3-ethylpenta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C(=C\C)CC)c1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C15H18F2/c1-5-12(6-2)11(3)13-7-9-14(10-8-13)15(4,16)17/h5,7-10H,3,6H2,1-2,4H3/b12-5- |
| InChIKey | FQKCPLWSDDYOBE-XGICHPGQSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|