C22H26S2-2 — CID 102081798
(Z)-1,2-bis(4-tert-butylphenyl)ethene-1,2-dithiolate (PubChem CID 102081798) has the molecular formula C22H26S2-2 and a molecular weight of 354.58 g/mol. Its IUPAC name is (Z)-1,2-bis(4-tert-butylphenyl)ethene-1,2-dithiolate.
| Compound Name | (Z)-1,2-bis(4-tert-butylphenyl)ethene-1,2-dithiolate |
|---|---|
| PubChem CID | 102081798 |
| Molecular Formula | C22H26S2-2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (Z)-1,2-bis(4-tert-butylphenyl)ethene-1,2-dithiolate |
| SMILES | CC(C)(C)c1ccc(/C([S-])=C(/[S-])c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H28S2/c1-21(2,3)17-11-7-15(8-12-17)19(23)20(24)16-9-13-18(14-10-16)22(4,5)6/h7-14,23-24H,1-6H3/p-2/b20-19- |
| InChIKey | DXMGKNHYZKWOIA-VXPUYCOJSA-L |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|