C17H20F4 — CID 143073321
2,4-bis(1,1-difluoroethyl)-1-[(3E)-4-methylhexa-1,3-dien-2-yl]benzene (PubChem CID 143073321) has the molecular formula C17H20F4 and a molecular weight of 300.34 g/mol. Its IUPAC name is 2,4-bis(1,1-difluoroethyl)-1-[(3E)-4-methylhexa-1,3-dien-2-yl]benzene.
| Compound Name | 2,4-bis(1,1-difluoroethyl)-1-[(3E)-4-methylhexa-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 143073321 |
| Molecular Formula | C17H20F4 |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2,4-bis(1,1-difluoroethyl)-1-[(3E)-4-methylhexa-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C=C(\C)CC)c1ccc(C(C)(F)F)cc1C(C)(F)F |
| InChI | InChI=1S/C17H20F4/c1-6-11(2)9-12(3)14-8-7-13(16(4,18)19)10-15(14)17(5,20)21/h7-10H,3,6H2,1-2,4-5H3/b11-9+ |
| InChIKey | ZAABWGYPKUNTAX-PKNBQFBNSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|