C10H8F5I — CID 89493278
2-(1,1-difluoroethyl)-1-(iodomethyl)-4-(trifluoromethyl)benzene (PubChem CID 89493278) has the molecular formula C10H8F5I and a molecular weight of 350.07 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-1-(iodomethyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2-(1,1-difluoroethyl)-1-(iodomethyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 89493278 |
| Molecular Formula | C10H8F5I |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 2-(1,1-difluoroethyl)-1-(iodomethyl)-4-(trifluoromethyl)benzene |
| SMILES | CC(F)(F)c1cc(C(F)(F)F)ccc1CI |
| InChI | InChI=1S/C10H8F5I/c1-9(11,12)8-4-7(10(13,14)15)3-2-6(8)5-16/h2-4H,5H2,1H3 |
| InChIKey | BAURPEDKJMRGFM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|