About 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene
4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene (PubChem CID 168747742) has the molecular formula C17H25F3
and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene |
| PubChem CID | 168747742 |
| Molecular Formula | C17H25F3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)CCc1ccc(C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C17H25F3/c1-15(2,3)10-9-12-7-8-13(16(4,5)6)11-14(12)17(18,19)20/h7-8,11H,9-10H2,1-6H3 |
| InChIKey | FZFSMYGEINYYBN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene?
The IUPAC name of 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene (CID 168747742) is 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene.
What is the SMILES notation for 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene?
The canonical SMILES for 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene is CC(C)(C)CCc1ccc(C(C)(C)C)cc1C(F)(F)F.
What is the InChIKey of 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene?
The InChIKey is FZFSMYGEINYYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3/c1-15(2,3)10-9-12-7-8-13(16(4,5)6)11-14(12)17(18,19)20/h7-8,11H,9-10H2,1-6H3.
What are the key properties of 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene?
4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene has a molecular weight of 286.38 g/mol, XLogP of 5.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-(3,3-dimethylbutyl)-2-(trifluoromethyl)benzene is sourced from PubChem (CID 168747742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).