C18H28F3N — CID 168747674
N-[[4-tert-butyl-2-(trifluoromethyl)phenyl]methyl]-N-ethyl-2-methylpropan-2-amine (PubChem CID 168747674) has the molecular formula C18H28F3N and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[[4-tert-butyl-2-(trifluoromethyl)phenyl]methyl]-N-ethyl-2-methylpropan-2-amine.
| Compound Name | N-[[4-tert-butyl-2-(trifluoromethyl)phenyl]methyl]-N-ethyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 168747674 |
| Molecular Formula | C18H28F3N |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[[4-tert-butyl-2-(trifluoromethyl)phenyl]methyl]-N-ethyl-2-methylpropan-2-amine |
| SMILES | CCN(Cc1ccc(C(C)(C)C)cc1C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C18H28F3N/c1-8-22(17(5,6)7)12-13-9-10-14(16(2,3)4)11-15(13)18(19,20)21/h9-11H,8,12H2,1-7H3 |
| InChIKey | LGSWLNRTDWGXAO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |