About 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile
3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile (PubChem CID 67179938) has the molecular formula C11H10F2N2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile |
| PubChem CID | 67179938 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile |
| SMILES | CC(F)(F)c1ccc(C(N)=CC#N)cc1 |
| InChI | InChI=1S/C11H10F2N2/c1-11(12,13)9-4-2-8(3-5-9)10(15)6-7-14/h2-6H,15H2,1H3 |
| InChIKey | HURYSNQJWWSELT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile?
The IUPAC name of 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile (CID 67179938) is 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile.
What is the SMILES notation for 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile?
The canonical SMILES for 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile is CC(F)(F)c1ccc(C(N)=CC#N)cc1.
What is the InChIKey of 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile?
The InChIKey is HURYSNQJWWSELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2/c1-11(12,13)9-4-2-8(3-5-9)10(15)6-7-14/h2-6H,15H2,1H3.
What are the key properties of 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile?
3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile has a molecular weight of 208.21 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enenitrile is sourced from PubChem (CID 67179938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).