C26H16CoN6O4 — CID 139155959
cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis(pyridine-2-carboxylate) (PubChem CID 139155959) has the molecular formula C26H16CoN6O4 and a molecular weight of 535.39 g/mol. Its IUPAC name is cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis(pyridine-2-carboxylate).
| Compound Name | cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis(pyridine-2-carboxylate) |
|---|---|
| PubChem CID | 139155959 |
| Molecular Formula | C26H16CoN6O4 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis(pyridine-2-carboxylate) |
| SMILES | O=C([O-])c1ccccn1.O=C([O-])c1ccccn1.[Co+2].c1cnc2c(c1)c1nccnc1c1cccnc12 |
| InChI | InChI=1S/C14H8N4.2C6H5NO2.Co/c1-3-9-11(15-5-1)12-10(4-2-6-16-12)14-13(9)17-7-8-18-14;2*8-6(9)5-3-1-2-4-7-5;/h1-8H;2*1-4H,(H,8,9);/q;;;+2/p-2 |
| InChIKey | PLBAHLBWGKYGOZ-UHFFFAOYSA-L |
| XLogP | 1.61 |
| TPSA | 157.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|