C54H50B2N18Ni — CID 139157860
nickel(2+);bis(tris(5-methyl-3-phenyl-1,2,4-triazol-1-yl)boranuide) (PubChem CID 139157860) has the molecular formula C54H50B2N18Ni and a molecular weight of 1031.44 g/mol. Its IUPAC name is nickel(2+);bis(tris(5-methyl-3-phenyl-1,2,4-triazol-1-yl)boranuide).
| Compound Name | nickel(2+);bis(tris(5-methyl-3-phenyl-1,2,4-triazol-1-yl)boranuide) |
|---|---|
| PubChem CID | 139157860 |
| Molecular Formula | C54H50B2N18Ni |
| Molecular Weight | 1031.44 g/mol |
| Exact Mass | 1030.40 |
| IUPAC Name | nickel(2+);bis(tris(5-methyl-3-phenyl-1,2,4-triazol-1-yl)boranuide) |
| SMILES | Cc1nc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)nc1C)n1nc(-c2ccccc2)nc1C.Cc1nc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)nc1C)n1nc(-c2ccccc2)nc1C.[Ni+2] |
| InChI | InChI=1S/2C27H25BN9.Ni/c2*1-19-29-25(22-13-7-4-8-14-22)32-35(19)28(36-20(2)30-26(33-36)23-15-9-5-10-16-23)37-21(3)31-27(34-37)24-17-11-6-12-18-24;/h2*4-18,28H,1-3H3;/q2*-1;+2 |
| InChIKey | ABQSCQIYIBCWRX-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 184.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.44 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|