C15H8F5N3 — CID 24764267
5-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3-phenyl-1,2,4-triazole (PubChem CID 24764267) has the molecular formula C15H8F5N3 and a molecular weight of 325.24 g/mol. Its IUPAC name is 5-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3-phenyl-1,2,4-triazole.
| Compound Name | 5-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 24764267 |
| Molecular Formula | C15H8F5N3 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3-phenyl-1,2,4-triazole |
| SMILES | Cc1nc(-c2ccccc2)nn1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F5N3/c1-7-21-15(8-5-3-2-4-6-8)22-23(7)14-12(19)10(17)9(16)11(18)13(14)20/h2-6H,1H3 |
| InChIKey | GCKVKYZOERAGFP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|