C15H13ClN3P — CID 145325422
[2-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]phenyl]phosphane (PubChem CID 145325422) has the molecular formula C15H13ClN3P and a molecular weight of 301.72 g/mol. Its IUPAC name is [2-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]phenyl]phosphane.
| Compound Name | [2-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 145325422 |
| Molecular Formula | C15H13ClN3P |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | [2-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]phenyl]phosphane |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)nn1-c1ccccc1P |
| InChI | InChI=1S/C15H13ClN3P/c1-10-17-15(11-6-8-12(16)9-7-11)18-19(10)13-4-2-3-5-14(13)20/h2-9H,20H2,1H3 |
| InChIKey | QLBLNBIWWVQXJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|