C66H50N6 — CID 89203630
1-[5-[3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazol-1-yl]naphthalen-1-yl]-3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazole (PubChem CID 89203630) has the molecular formula C66H50N6 and a molecular weight of 927.17 g/mol. Its IUPAC name is 1-[5-[3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazol-1-yl]naphthalen-1-yl]-3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazole.
| Compound Name | 1-[5-[3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazol-1-yl]naphthalen-1-yl]-3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 89203630 |
| Molecular Formula | C66H50N6 |
| Molecular Weight | 927.17 g/mol |
| Exact Mass | 926.41 |
| IUPAC Name | 1-[5-[3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazol-1-yl]naphthalen-1-yl]-3,5-bis[4-(4-methylphenyl)phenyl]-1,2,4-triazole |
| SMILES | Cc1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(C)cc5)cc4)n(-c4cccc5c(-n6nc(-c7ccc(-c8ccc(C)cc8)cc7)nc6-c6ccc(-c7ccc(C)cc7)cc6)cccc45)n3)cc2)cc1 |
| InChI | InChI=1S/C66H50N6/c1-43-11-19-47(20-12-43)51-27-35-55(36-28-51)63-67-65(57-39-31-53(32-40-57)49-23-15-45(3)16-24-49)71(69-63)61-9-5-8-60-59(61)7-6-10-62(60)72-66(58-41-33-54(34-42-58)50-25-17-46(4)18-26-50)68-64(70-72)56-37-29-52(30-38-56)48-21-13-44(2)14-22-48/h5-42H,1-4H3 |
| InChIKey | NRBBFADUORDXLY-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.17 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |