C14H12N4S — CID 134860533
4-(5-methylsulfanyl-1-phenyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 134860533) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 4-(5-methylsulfanyl-1-phenyl-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 4-(5-methylsulfanyl-1-phenyl-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 134860533 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(5-methylsulfanyl-1-phenyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | CSc1nc(-c2ccncc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C14H12N4S/c1-19-14-16-13(11-7-9-15-10-8-11)17-18(14)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | QYUCCQJRPLTOPU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |