C29H20BNOS — CID 139160728
11,11-diphenyl-12-oxa-3-thia-10-azonia-11-boranuidapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene (PubChem CID 139160728) has the molecular formula C29H20BNOS and a molecular weight of 441.36 g/mol. Its IUPAC name is 11,11-diphenyl-12-oxa-3-thia-10-azonia-11-boranuidapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene.
| Compound Name | 11,11-diphenyl-12-oxa-3-thia-10-azonia-11-boranuidapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 139160728 |
| Molecular Formula | C29H20BNOS |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 11,11-diphenyl-12-oxa-3-thia-10-azonia-11-boranuidapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(13),2(10),4,6,8,14,16,18,20-nonaene |
| SMILES | c1ccc([B-]2(c3ccccc3)Oc3c(ccc4ccccc34)-c3sc4ccccc4[n+]32)cc1 |
| InChI | InChI=1S/C29H20BNOS/c1-3-12-22(13-4-1)30(23-14-5-2-6-15-23)31-26-17-9-10-18-27(26)33-29(31)25-20-19-21-11-7-8-16-24(21)28(25)32-30/h1-20H |
| InChIKey | OYJLNNBOSFUSOZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|